SCH-79687
|
|
| Names
|
Preferred IUPAC name
N-(3,5-Dichlorophenyl)-N′-({4-[(1H-imidazol-4-yl)methyl]phenyl}methyl)urea
|
| Identifiers
|
|
|
|
|
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C18H16Cl2N4O/c19-14-6-15(20)8-16(7-14)24-18(25)22-9-13-3-1-12(2-4-13)5-17-10-21-11-23-17/h1-4,6-8,10-11H,5,9H2,(H,21,23)(H2,22,24,25) Y Key: CXNCQFJNXQAFND-UHFFFAOYSA-N Y InChI=1/C18H16Cl2N4O/c19-14-6-15(20)8-16(7-14)24-18(25)22-9-13-3-1-12(2-4-13)5-17-10-21-11-23-17/h1-4,6-8,10-11H,5,9H2,(H,21,23)(H2,22,24,25) Key: CXNCQFJNXQAFND-UHFFFAOYAC
|
Clc1cc(cc(Cl)c1)NC(=O)NCc2ccc(cc2)Cc3c[nH]cn3
|
| Properties
|
|
|
C18H16Cl2N4O
|
| Molar mass
|
375.251 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
SCH-79687 is a histamine antagonist selective for the H3 subtype.[1]
References
- ^ McLeod, RL; Rizzo, CA; West, RE Jr; Aslanian, R; McCormick, K; Bryant, M; Hsieh, Y; Korfmacher, W; Mingo, GG; Varty, L; Williams, SM; Shih, NY; Egan, RW; Hey, JA (Jun 2003). "Pharmacological characterization of the novel histamine H3-receptor antagonist N-(3,5-dichlorophenyl)-N'-[[4-(1H-imidazol-4-ylmethyl)phenyl]-methyl]-urea (SCH 79687)". Journal of Pharmacology and Experimental Therapeutics. 305 (3): 1037–44. doi:10.1124/jpet.103.049254. PMID 12649305.
|
|---|
| H1 | | Agonists | |
|---|
| Antagonists |
- Others: Atypical antipsychotics (e.g., aripiprazole, asenapine, brexpiprazole, brilaroxazine, clozapine, iloperidone, olanzapine, paliperidone, quetiapine, risperidone, ziprasidone, zotepine)
- Phenylpiperazine antidepressants (e.g., hydroxynefazodone, nefazodone, trazodone, triazoledione)
- Tetracyclic antidepressants (e.g., amoxapine, loxapine, maprotiline, mianserin, mirtazapine, oxaprotiline)
- Tricyclic antidepressants (e.g., amitriptyline, butriptyline, clomipramine, desipramine, dosulepin (dothiepin), doxepin, imipramine, iprindole, lofepramine, nortriptyline, protriptyline, trimipramine)
- Typical antipsychotics (e.g., chlorpromazine, flupenthixol, fluphenazine, loxapine, perphenazine, prochlorperazine, thioridazine, thiothixene)
- Unknown/unsorted: Azanator
- Belarizine
- Elbanizine
- Flotrenizine
- GSK1004723
- Napactadine
- Tagorizine
- Trelnarizine
- Trenizine
|
|---|
|
|---|
| H2 | |
|---|
| H3 | |
|---|
| H4 | |
|---|
- See also
- Receptor/signaling modulators
- Monoamine metabolism modulators
- Monoamine reuptake inhibitors
|