Nupharin A
|
|
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
|
|
|
|
|
|
InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)62-9-23-33-34(65-40(61)14-8-22(49)30(54)32(56)25(14)24-13(39(60)64-33)7-21(48)29(53)31(24)55)35(66-37(58)11-3-17(44)27(51)18(45)4-11)41(63-23)67-38(59)12-5-19(46)28(52)20(47)6-12/h1-8,23,33-35,41-56H,9H2/t23-,33-,34+,35-,41+/m1/s1 Key: ZQYQKZCDCFVYLV-UUUCSUBKSA-N InChI=1/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)62-9-23-33-34(65-40(61)14-8-22(49)30(54)32(56)25(14)24-13(39(60)64-33)7-21(48)29(53)31(24)55)35(66-37(58)11-3-17(44)27(51)18(45)4-11)41(63-23)67-38(59)12-5-19(46)28(52)20(47)6-12/h1-8,23,33-35,41-56H,9H2/t23-,33-,34+,35-,41+/m1/s1 Key: ZQYQKZCDCFVYLV-UUUCSUBKBO
|
O=C3O[C@H]7[C@H](OC(=O)c1c(c(O)c(O)c(O)c1)c2c(O)c(O)c(O)cc23)[C@@H](OC(=O)c4cc(O)c(O)c(O)c4)[C@H](OC(=O)c5cc(O)c(O)c(O)c5)O[C@@H]7COC(=O)c6cc(O)c(O)c(O)c6
|
| Properties
|
|
|
C41H30O26
|
| Molar mass
|
938.66 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Nupharin A is an ellagitannin found in Nuphar japonica.[1] It is a molecule with three gallic acid units and one hexahydroxydiphenic acid unit attached to a glucose residue. It is an isomer of punicafolin and tellimagrandin II.
References
- ^ Tannins and Related Compounds. LXXV. : Isolation and Characterization of Novel Diastereoisomeric Ellagitannins, Nupharins A and B, and Their Homologues from Nuphar japonicum DC. Chemical & Pharmaceutical Bulletin, 25 January 1989, volume 37, issue 1, pages 129-134 (abstract)
|
|---|
| Moieties | |
|---|
| Lactones | |
|---|
| Monomers |
- Acetonyl geraniin
- Alnusiin
- Bicornin
- Carlesiin
- Casuarictin
- Emblicanin A and B
- Euscaphinin
- Galloyl pedunculagin
- Grandinin
- Helioscopinin B
- Jolkinin
- Lagerstannin A, B and C
- Macranganin
- Myrobalanitannin
- Nupharin A, B, C, D, E and F
- Pedunculagin
- Punicalagin
- Punigluconin
- Phyllanemblinin A, B, C, D, E and F
- Punicalin
- Roburin E
- Rugosin E
- Sanguiin H-5
- Stenophyllanin A, B and C
- Strictinin
- Tellimagrandin I and II
- Teracatain
- Terchebulin
- Terflavin A and B
- Tergallic acid
- Tergallic acid dilactone
| C-glycosidic ellagitannins | |
|---|
Dehydroellagitannins (molecules with dehydrohexahydroxydiphenic acid (DHHDP) | |
|---|
| Transformed ellagitannins | | molecules with chebulic acid | |
|---|
| molecules with Elaeocarpusinic acid |
- Elaeocarpusin
- Helioscopin B
- Mallojaponin (1-O-Galloyl-2,4-elaeocarpusinoyl-3,6-(R)-valoneayl-beta-D-glucose)
|
|---|
|
|---|
|
|---|
| Oligomers | |
|---|
| Other | |
|---|
Category |