Karanjin
|
|
| Names
|
| IUPAC name
3-Methoxyfuro[2′′,3′′:7,8]flavone
|
Systematic IUPAC name
3-Methoxy-2-phenyl-4H-furo[2,3-h][1]benzopyran-4-one
|
| Identifiers
|
|
|
|
|
|
|
| ChEMBL
|
|
| ChemSpider
|
|
| ECHA InfoCard
|
100.007.565
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C18H12O4/c1-20-18-15(19)13-7-8-14-12(9-10-21-14)17(13)22-16(18)11-5-3-2-4-6-11/h2-10H,1H3 Y Key: LKPQNZRGGNOPPU-UHFFFAOYSA-N Y
|
C1(=C(OC2=C(C1=O)C=CC3=C2C=CO3)C4=CC=CC=C4)OC O=C2C(\OC)=C(/Oc3c1ccoc1ccc23)c4ccccc4
|
| Properties
|
|
|
C18H12O4
|
| Molar mass
|
292.290 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
Karanjin is a furanoflavonol, a type of flavonoid. It is obtained from the seeds of the karanja tree (Millettia pinnata or Pongamia glabra Vent.), a tree growing wild in south India. Karanjin is an acaricide and insecticide. Karanjin is reported to have nitrification inhibitory properties.[1]
References
- ^ Majumdar, Deepanjan; Pandya, Bhavesh; Arora, Anu; Dhara, Soni (2004). "Potential use of karanjin (3-methoxy furano-2′,3′,7,8-flavone) as a nitrification inhibitor in different soil types". Archives of Agronomy and Soil Science. 50 (4–5): 455. doi:10.1080/03650340410001689406. S2CID 96706313.
Flavonols and their conjugates |
|---|
| Backbone | |
|---|
| Flavonols | | Aglycones | |
|---|
| Conjugates | | Glycosides of herbacetin | |
|---|
| Glycosides of kaempferol |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
|---|
| Glycosides of myricetin | |
|---|
| Conjugates of quercetin | |
|---|
|
|---|
|
|---|
| O-Methylated flavonols | | Aglycones | |
|---|
| Glycosides | | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
|---|
| other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
|---|
|
|---|
|
|---|
| Derivative flavonols | | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
|---|
| Glycosides | |
|---|
|
|---|
| Pyranoflavonols | |
|---|
| Furanoflavonols | |
|---|
| Semisynthetic | |
|---|
Category |