Alloisoleucine
| Identifiers | |
|---|---|
3D model (JSmol)
|
|
| 1721791 | |
| ChEBI |
|
| ChEMBL |
|
| ChemSpider | |
| DrugBank |
|
| ECHA InfoCard | 100.014.676 |
| EC Number |
|
PubChem CID
|
|
| UNII |
|
CompTox Dashboard (EPA)
|
|
| |
| |
| Properties | |
| C6H13NO2 | |
| Molar mass | 131.175 g·mol−1 |
| Appearance | white solid |
| Melting point | 285 °C (545 °F; 558 K) |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
| |
Alloisoleucine is an amino acid with the formula CH3CH2CH(CH3)CH(NH2)CO2H. It is the diastereomer of isoleucine, differing in the stereochemistry within the side chain. Alloisoleucine exists as two enantiomers, of which the L isomer occurs naturally. L-Alloisoleucine occurs in healthy serum in only trace amounts, except for individuals suffering from maple syrup urine disease.[1]
Structure
Together with valine, leucine, and isoleucine, alloisoleucine is classified as a branched-chain amino acid (BCAA). The L enantiomer of valine, leucine, and isoleucine are proteinogenic amino acids; alloisoleucine is non-proteinogenic.
| |
| l-isoleucine (2S,3S) and d-isoleucine (2R,3R) |
| |
| l-alloisoleucine (2S,3R) and d-alloisoleucine (2R,3S) |
Role in biosynthesis
L-Alloisoleucine is a precursor to coronatine, a phytotoxin produced by Pseudomonas syringae.[2]
References
- ^ Schadewaldt, Peter; Bodner-Leidecker, Annette; Hammen, Hans-Werner; Wendel, Udo (2000). "Formation of L-Alloisoleucine in Vivo: An L-[13C]Isoleucine Study in Man". Pediatric Research. 47 (2): 271–277. doi:10.1203/00006450-200002000-00020. PMID 10674358. S2CID 530588.
- ^ Vaillancourt, Frédéric H.; Yeh, Ellen; Vosburg, David A.; O'Connor, Sarah E.; Walsh, Christopher T. (August 2005). "Cryptic chlorination by a non-haem iron enzyme during cyclopropyl amino acid biosynthesis". Nature. 436 (7054): 1191–1194. Bibcode:2005Natur.436.1191V. doi:10.1038/nature03797. ISSN 1476-4687. PMID 16121186. S2CID 4428247.