5,7-Dichlorokynurenic acid
|
|
| Names
|
Preferred IUPAC name
5,7-Dichloro-4-oxo-1,4-dihydroquinoline-2-carboxylic acid
|
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
|
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C10H5Cl2NO3/c11-4-1-5(12)9-6(2-4)13-7(10(15)16)3-8(9)14/h1-3H,(H,13,14)(H,15,16) N Key: BGKFPRIGXAVYNX-UHFFFAOYSA-N N InChI=1/C10H5Cl2NO3/c11-4-1-5(12)9-6(2-4)13-7(10(15)16)3-8(9)14/h1-3H,(H,13,14)(H,15,16) Key: BGKFPRIGXAVYNX-UHFFFAOYAD
|
C1=C(C=C2C(=C1Cl)C(=O)C=C(N2)C(=O)O)Cl
|
| Properties
|
|
|
C10H5Cl2NO3
|
| Molar mass
|
258.05 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references
|
5,7-Dichlorokynurenic acid (DCKA) is a selective NMDA receptor antagonist acting at the glycine site of the NMDA receptor complex.[1]
See also
References
- ^ McNamara, D; Smith, EC; Calligaro, DO; O'Malley, PJ; McQuaid, LA; Dingledine, R (November 1990). "5,7-Dichlorokynurenic acid, a potent and selective competitive antagonist of the glycine site on NMDA receptors". Neuroscience Letters. 120: 17–20. PMID 2149877.
|
|---|
| AMPARTooltip α-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid receptor | |
|---|
| KARTooltip Kainate receptor | |
|---|
| NMDARTooltip N-Methyl-D-aspartate receptor | |
|---|
- See also: Receptor/signaling modulators
- Metabotropic glutamate receptor modulators
- Glutamate metabolism/transport modulators
|